C12H15NO5S2 — CID 107820540
(2R)-5-methoxy-5-oxo-2-[(2-thiophen-2-ylsulfanylacetyl)amino]pentanoic acid (PubChem CID 107820540) has the molecular formula C12H15NO5S2 and a molecular weight of 317.39 g/mol. Its IUPAC name is (2R)-5-methoxy-5-oxo-2-[(2-thiophen-2-ylsulfanylacetyl)amino]pentanoic acid.
| Compound Name | (2R)-5-methoxy-5-oxo-2-[(2-thiophen-2-ylsulfanylacetyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 107820540 |
| Molecular Formula | C12H15NO5S2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | (2R)-5-methoxy-5-oxo-2-[(2-thiophen-2-ylsulfanylacetyl)amino]pentanoic acid |
| SMILES | COC(=O)CC[C@@H](NC(=O)CSc1cccs1)C(=O)O |
| InChI | InChI=1S/C12H15NO5S2/c1-18-10(15)5-4-8(12(16)17)13-9(14)7-20-11-3-2-6-19-11/h2-3,6,8H,4-5,7H2,1H3,(H,13,14)(H,16,17)/t8-/m1/s1 |
| InChIKey | SZJJTTSDGFOPIR-MRVPVSSYSA-N |
| XLogP | 1.36 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |