C14H17NO6 — CID 107820559
(2R)-2-[[2-(2-hydroxyphenyl)acetyl]amino]-5-methoxy-5-oxopentanoic acid (PubChem CID 107820559) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is (2R)-2-[[2-(2-hydroxyphenyl)acetyl]amino]-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2R)-2-[[2-(2-hydroxyphenyl)acetyl]amino]-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107820559 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | (2R)-2-[[2-(2-hydroxyphenyl)acetyl]amino]-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CC[C@@H](NC(=O)Cc1ccccc1O)C(=O)O |
| InChI | InChI=1S/C14H17NO6/c1-21-13(18)7-6-10(14(19)20)15-12(17)8-9-4-2-3-5-11(9)16/h2-5,10,16H,6-8H2,1H3,(H,15,17)(H,19,20)/t10-/m1/s1 |
| InChIKey | KSAIVJDYNYRNFF-SNVBAGLBSA-N |
| XLogP | 0.46 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |