C12H15NO5 — CID 6543579
(2S)-2-[(2-hydroxyphenyl)methylamino]-4-methoxy-4-oxobutanoic acid (PubChem CID 6543579) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is (2S)-2-[(2-hydroxyphenyl)methylamino]-4-methoxy-4-oxobutanoic acid.
| Compound Name | (2S)-2-[(2-hydroxyphenyl)methylamino]-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 6543579 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | (2S)-2-[(2-hydroxyphenyl)methylamino]-4-methoxy-4-oxobutanoic acid |
| SMILES | COC(=O)C[C@H](NCc1ccccc1O)C(=O)O |
| InChI | InChI=1S/C12H15NO5/c1-18-11(15)6-9(12(16)17)13-7-8-4-2-3-5-10(8)14/h2-5,9,13-14H,6-7H2,1H3,(H,16,17)/t9-/m0/s1 |
| InChIKey | MGKIFNXJFGCNGY-VIFPVBQESA-N |
| XLogP | 0.50 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|