C14H19NO5 — CID 142855999
2-benzamido-4-methoxy-4-oxobutanoic acid;ethane (PubChem CID 142855999) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is 2-benzamido-4-methoxy-4-oxobutanoic acid;ethane.
| Compound Name | 2-benzamido-4-methoxy-4-oxobutanoic acid;ethane |
|---|---|
| PubChem CID | 142855999 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 2-benzamido-4-methoxy-4-oxobutanoic acid;ethane |
| SMILES | CC.COC(=O)CC(NC(=O)c1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H13NO5.C2H6/c1-18-10(14)7-9(12(16)17)13-11(15)8-5-3-2-4-6-8;1-2/h2-6,9H,7H2,1H3,(H,13,15)(H,16,17);1-2H3 |
| InChIKey | MJYKSYUVHLTROT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |