C10H10INO5S — CID 79685650
(2S)-2-[(5-iodothiophene-3-carbonyl)amino]-4-methoxy-4-oxobutanoic acid (PubChem CID 79685650) has the molecular formula C10H10INO5S and a molecular weight of 383.16 g/mol. Its IUPAC name is (2S)-2-[(5-iodothiophene-3-carbonyl)amino]-4-methoxy-4-oxobutanoic acid.
| Compound Name | (2S)-2-[(5-iodothiophene-3-carbonyl)amino]-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 79685650 |
| Molecular Formula | C10H10INO5S |
| Molecular Weight | 383.16 g/mol |
| Exact Mass | 382.93 |
| IUPAC Name | (2S)-2-[(5-iodothiophene-3-carbonyl)amino]-4-methoxy-4-oxobutanoic acid |
| SMILES | COC(=O)C[C@H](NC(=O)c1csc(I)c1)C(=O)O |
| InChI | InChI=1S/C10H10INO5S/c1-17-8(13)3-6(10(15)16)12-9(14)5-2-7(11)18-4-5/h2,4,6H,3H2,1H3,(H,12,14)(H,15,16)/t6-/m0/s1 |
| InChIKey | PBHUPQWJVPROAC-LURJTMIESA-N |
| XLogP | 1.10 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.16 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|