C10H12INO3S — CID 79684876
(2S)-2-[(5-iodothiophene-3-carbonyl)amino]-3-methylbutanoic acid (PubChem CID 79684876) has the molecular formula C10H12INO3S and a molecular weight of 353.18 g/mol. Its IUPAC name is (2S)-2-[(5-iodothiophene-3-carbonyl)amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[(5-iodothiophene-3-carbonyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 79684876 |
| Molecular Formula | C10H12INO3S |
| Molecular Weight | 353.18 g/mol |
| Exact Mass | 352.96 |
| IUPAC Name | (2S)-2-[(5-iodothiophene-3-carbonyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)c1csc(I)c1)C(=O)O |
| InChI | InChI=1S/C10H12INO3S/c1-5(2)8(10(14)15)12-9(13)6-3-7(11)16-4-6/h3-5,8H,1-2H3,(H,12,13)(H,14,15)/t8-/m0/s1 |
| InChIKey | ACNXJAUMCVSCBQ-QMMMGPOBSA-N |
| XLogP | 2.19 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.18 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|