C9H9F3INOS — CID 104854913
5-iodo-N-(4,4,4-trifluorobutan-2-yl)thiophene-3-carboxamide (PubChem CID 104854913) has the molecular formula C9H9F3INOS and a molecular weight of 363.14 g/mol. Its IUPAC name is 5-iodo-N-(4,4,4-trifluorobutan-2-yl)thiophene-3-carboxamide.
| Compound Name | 5-iodo-N-(4,4,4-trifluorobutan-2-yl)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 104854913 |
| Molecular Formula | C9H9F3INOS |
| Molecular Weight | 363.14 g/mol |
| Exact Mass | 362.94 |
| IUPAC Name | 5-iodo-N-(4,4,4-trifluorobutan-2-yl)thiophene-3-carboxamide |
| SMILES | CC(CC(F)(F)F)NC(=O)c1csc(I)c1 |
| InChI | InChI=1S/C9H9F3INOS/c1-5(3-9(10,11)12)14-8(15)6-2-7(13)16-4-6/h2,4-5H,3H2,1H3,(H,14,15) |
| InChIKey | HWAKNQZBBBXYEJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.14 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|