C10H12BrNO3S — CID 43354005
2-[(5-bromothiophene-3-carbonyl)amino]-3-methylbutanoic acid (PubChem CID 43354005) has the molecular formula C10H12BrNO3S and a molecular weight of 306.18 g/mol. Its IUPAC name is 2-[(5-bromothiophene-3-carbonyl)amino]-3-methylbutanoic acid.
| Compound Name | 2-[(5-bromothiophene-3-carbonyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 43354005 |
| Molecular Formula | C10H12BrNO3S |
| Molecular Weight | 306.18 g/mol |
| Exact Mass | 304.97 |
| IUPAC Name | 2-[(5-bromothiophene-3-carbonyl)amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)c1csc(Br)c1)C(=O)O |
| InChI | InChI=1S/C10H12BrNO3S/c1-5(2)8(10(14)15)12-9(13)6-3-7(11)16-4-6/h3-5,8H,1-2H3,(H,12,13)(H,14,15) |
| InChIKey | MUNCOWKSZGRBAX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.18 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |