C12H17NO3S — CID 10060925
ethyl (2S)-2-[(2-hydroxyphenyl)methylamino]-3-sulfanylpropanoate (PubChem CID 10060925) has the molecular formula C12H17NO3S and a molecular weight of 255.34 g/mol. Its IUPAC name is ethyl (2S)-2-[(2-hydroxyphenyl)methylamino]-3-sulfanylpropanoate.
| Compound Name | ethyl (2S)-2-[(2-hydroxyphenyl)methylamino]-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 10060925 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | ethyl (2S)-2-[(2-hydroxyphenyl)methylamino]-3-sulfanylpropanoate |
| SMILES | CCOC(=O)[C@@H](CS)NCc1ccccc1O |
| InChI | InChI=1S/C12H17NO3S/c1-2-16-12(15)10(8-17)13-7-9-5-3-4-6-11(9)14/h3-6,10,13-14,17H,2,7-8H2,1H3/t10-/m1/s1 |
| InChIKey | WTEUTDWBXJSADA-SNVBAGLBSA-N |
| XLogP | 1.34 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|