C15H24N4O3 — CID 54063362
ethyl (2S)-5-(diaminomethylideneamino)-2-[(2-hydroxyphenyl)methylamino]pentanoate (PubChem CID 54063362) has the molecular formula C15H24N4O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is ethyl (2S)-5-(diaminomethylideneamino)-2-[(2-hydroxyphenyl)methylamino]pentanoate.
| Compound Name | ethyl (2S)-5-(diaminomethylideneamino)-2-[(2-hydroxyphenyl)methylamino]pentanoate |
|---|---|
| PubChem CID | 54063362 |
| Molecular Formula | C15H24N4O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | ethyl (2S)-5-(diaminomethylideneamino)-2-[(2-hydroxyphenyl)methylamino]pentanoate |
| SMILES | CCOC(=O)[C@H](CCCN=C(N)N)NCc1ccccc1O |
| InChI | InChI=1S/C15H24N4O3/c1-2-22-14(21)12(7-5-9-18-15(16)17)19-10-11-6-3-4-8-13(11)20/h3-4,6,8,12,19-20H,2,5,7,9-10H2,1H3,(H4,16,17,18)/t12-/m0/s1 |
| InChIKey | MBHFFTYIVFXXJQ-LBPRGKRZSA-N |
| XLogP | 0.47 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|