C20H40ClN4O3- — CID 162290476
ethyl 5-(diaminomethylideneamino)-2-(2-methylundecanoylamino)pentanoate chloride (PubChem CID 162290476) has the molecular formula C20H40ClN4O3- and a molecular weight of 420.02 g/mol. Its IUPAC name is ethyl 5-(diaminomethylideneamino)-2-(2-methylundecanoylamino)pentanoate chloride.
| Compound Name | ethyl 5-(diaminomethylideneamino)-2-(2-methylundecanoylamino)pentanoate chloride |
|---|---|
| PubChem CID | 162290476 |
| Molecular Formula | C20H40ClN4O3- |
| Molecular Weight | 420.02 g/mol |
| Exact Mass | 419.28 |
| IUPAC Name | ethyl 5-(diaminomethylideneamino)-2-(2-methylundecanoylamino)pentanoate chloride |
| SMILES | CCCCCCCCCC(C)C(=O)NC(CCCN=C(N)N)C(=O)OCC.[Cl-] |
| InChI | InChI=1S/C20H40N4O3.ClH/c1-4-6-7-8-9-10-11-13-16(3)18(25)24-17(19(26)27-5-2)14-12-15-23-20(21)22;/h16-17H,4-15H2,1-3H3,(H,24,25)(H4,21,22,23);1H/p-1 |
| InChIKey | BZJYBYSRTJRRPE-UHFFFAOYSA-M |
| XLogP | -0.13 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.02 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|