C9H19ClN4O3 — CID 141184905
ethyl (2S)-5-(diaminomethylideneamino)-2-formamidopentanoate;hydrochloride (PubChem CID 141184905) has the molecular formula C9H19ClN4O3 and a molecular weight of 266.73 g/mol. Its IUPAC name is ethyl (2S)-5-(diaminomethylideneamino)-2-formamidopentanoate;hydrochloride.
| Compound Name | ethyl (2S)-5-(diaminomethylideneamino)-2-formamidopentanoate;hydrochloride |
|---|---|
| PubChem CID | 141184905 |
| Molecular Formula | C9H19ClN4O3 |
| Molecular Weight | 266.73 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | ethyl (2S)-5-(diaminomethylideneamino)-2-formamidopentanoate;hydrochloride |
| SMILES | CCOC(=O)[C@H](CCCN=C(N)N)NC=O.Cl |
| InChI | InChI=1S/C9H18N4O3.ClH/c1-2-16-8(15)7(13-6-14)4-3-5-12-9(10)11;/h6-7H,2-5H2,1H3,(H,13,14)(H4,10,11,12);1H/t7-;/m0./s1 |
| InChIKey | RNGOTDQRICFWNI-FJXQXJEOSA-N |
| XLogP | -0.86 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.73 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|