C15H22ClN4O3- — CID 45108589
ethyl (2S)-2-benzamido-5-(diaminomethylideneamino)pentanoate chloride (PubChem CID 45108589) has the molecular formula C15H22ClN4O3- and a molecular weight of 341.82 g/mol. Its IUPAC name is ethyl (2S)-2-benzamido-5-(diaminomethylideneamino)pentanoate chloride.
| Compound Name | ethyl (2S)-2-benzamido-5-(diaminomethylideneamino)pentanoate chloride |
|---|---|
| PubChem CID | 45108589 |
| Molecular Formula | C15H22ClN4O3- |
| Molecular Weight | 341.82 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | ethyl (2S)-2-benzamido-5-(diaminomethylideneamino)pentanoate chloride |
| SMILES | CCOC(=O)[C@H](CCCN=C(N)N)NC(=O)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C15H22N4O3.ClH/c1-2-22-14(21)12(9-6-10-18-15(16)17)19-13(20)11-7-4-3-5-8-11;/h3-5,7-8,12H,2,6,9-10H2,1H3,(H,19,20)(H4,16,17,18);1H/p-1/t12-;/m0./s1 |
| InChIKey | HIXDELXKSSLIKB-YDALLXLXSA-M |
| XLogP | -2.59 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.82 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|