C19H24N6O5 — CID 66595285
(2S)-2-benzamido-5-(diaminomethylideneamino)pentanoic acid;4-nitroaniline (PubChem CID 66595285) has the molecular formula C19H24N6O5 and a molecular weight of 416.44 g/mol. Its IUPAC name is (2S)-2-benzamido-5-(diaminomethylideneamino)pentanoic acid;4-nitroaniline.
| Compound Name | (2S)-2-benzamido-5-(diaminomethylideneamino)pentanoic acid;4-nitroaniline |
|---|---|
| PubChem CID | 66595285 |
| Molecular Formula | C19H24N6O5 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | (2S)-2-benzamido-5-(diaminomethylideneamino)pentanoic acid;4-nitroaniline |
| SMILES | NC(N)=NCCC[C@H](NC(=O)c1ccccc1)C(=O)O.Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H18N4O3.C6H6N2O2/c14-13(15)16-8-4-7-10(12(19)20)17-11(18)9-5-2-1-3-6-9;7-5-1-3-6(4-2-5)8(9)10/h1-3,5-6,10H,4,7-8H2,(H,17,18)(H,19,20)(H4,14,15,16);1-4H,7H2/t10-;/m0./s1 |
| InChIKey | SYMMRXYGBPWHAB-PPHPATTJSA-N |
| XLogP | 1.10 |
| TPSA | 199.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|