C14H20N6O4 — CID 129360490
(2R)-2-acetamido-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide (PubChem CID 129360490) has the molecular formula C14H20N6O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is (2R)-2-acetamido-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide.
| Compound Name | (2R)-2-acetamido-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide |
|---|---|
| PubChem CID | 129360490 |
| Molecular Formula | C14H20N6O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (2R)-2-acetamido-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide |
| SMILES | CC(=O)N[C@H](CCCN=C(N)N)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H20N6O4/c1-9(21)18-12(3-2-8-17-14(15)16)13(22)19-10-4-6-11(7-5-10)20(23)24/h4-7,12H,2-3,8H2,1H3,(H,18,21)(H,19,22)(H4,15,16,17)/t12-/m1/s1 |
| InChIKey | NVTKZNQMDICGHC-GFCCVEGCSA-N |
| XLogP | 0.09 |
| TPSA | 165.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|