C22H37N11O7S — CID 67923311
(2S)-5-(diaminomethylideneamino)-2-[[2-[[(2R)-5-(diaminomethylideneamino)-2-(ethylsulfonylamino)pentanoyl]amino]acetyl]amino]-N-(4-nitrophenyl)pentanamide (PubChem CID 67923311) has the molecular formula C22H37N11O7S and a molecular weight of 599.68 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-[[2-[[(2R)-5-(diaminomethylideneamino)-2-(ethylsulfonylamino)pentanoyl]amino]acetyl]amino]-N-(4-nitrophenyl)pentanamide.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-[[2-[[(2R)-5-(diaminomethylideneamino)-2-(ethylsulfonylamino)pentanoyl]amino]acetyl]amino]-N-(4-nitrophenyl)pentanamide |
|---|---|
| PubChem CID | 67923311 |
| Molecular Formula | C22H37N11O7S |
| Molecular Weight | 599.68 g/mol |
| Exact Mass | 599.26 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-[[2-[[(2R)-5-(diaminomethylideneamino)-2-(ethylsulfonylamino)pentanoyl]amino]acetyl]amino]-N-(4-nitrophenyl)pentanamide |
| SMILES | CCS(=O)(=O)N[C@H](CCCN=C(N)N)C(=O)NCC(=O)N[C@@H](CCCN=C(N)N)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H37N11O7S/c1-2-41(39,40)32-17(6-4-12-28-22(25)26)19(35)29-13-18(34)31-16(5-3-11-27-21(23)24)20(36)30-14-7-9-15(10-8-14)33(37)38/h7-10,16-17,32H,2-6,11-13H2,1H3,(H,29,35)(H,30,36)(H,31,34)(H4,23,24,27)(H4,25,26,28)/t16-,17+/m0/s1 |
| InChIKey | JCCOGYJQMMXOKM-DLBZAZTESA-N |
| XLogP | -2.45 |
| TPSA | 305.41 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.68 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|