C24H38N8O6 — CID 91895898
2-[2-[[2-amino-3-(4-hydroxycyclohexyl)propanoyl]amino]propanoylamino]-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide (PubChem CID 91895898) has the molecular formula C24H38N8O6 and a molecular weight of 534.62 g/mol. Its IUPAC name is 2-[2-[[2-amino-3-(4-hydroxycyclohexyl)propanoyl]amino]propanoylamino]-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide.
| Compound Name | 2-[2-[[2-amino-3-(4-hydroxycyclohexyl)propanoyl]amino]propanoylamino]-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide |
|---|---|
| PubChem CID | 91895898 |
| Molecular Formula | C24H38N8O6 |
| Molecular Weight | 534.62 g/mol |
| Exact Mass | 534.29 |
| IUPAC Name | 2-[2-[[2-amino-3-(4-hydroxycyclohexyl)propanoyl]amino]propanoylamino]-5-(diaminomethylideneamino)-N-(4-nitrophenyl)pentanamide |
| SMILES | CC(NC(=O)C(N)CC1CCC(O)CC1)C(=O)NC(CCCN=C(N)N)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H38N8O6/c1-14(29-22(35)19(25)13-15-4-10-18(33)11-5-15)21(34)31-20(3-2-12-28-24(26)27)23(36)30-16-6-8-17(9-7-16)32(37)38/h6-9,14-15,18-20,33H,2-5,10-13,25H2,1H3,(H,29,35)(H,30,36)(H,31,34)(H4,26,27,28) |
| InChIKey | AAHHUPISDJCLQV-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 241.09 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.62 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|