C26H36N8O6 — CID 71334063
2-amino-5-(diaminomethylideneamino)-N-[1-[[3-(4-hydroxyphenyl)-1-(4-nitroanilino)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]pentanamide (PubChem CID 71334063) has the molecular formula C26H36N8O6 and a molecular weight of 556.62 g/mol. Its IUPAC name is 2-amino-5-(diaminomethylideneamino)-N-[1-[[3-(4-hydroxyphenyl)-1-(4-nitroanilino)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]pentanamide.
| Compound Name | 2-amino-5-(diaminomethylideneamino)-N-[1-[[3-(4-hydroxyphenyl)-1-(4-nitroanilino)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]pentanamide |
|---|---|
| PubChem CID | 71334063 |
| Molecular Formula | C26H36N8O6 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.28 |
| IUPAC Name | 2-amino-5-(diaminomethylideneamino)-N-[1-[[3-(4-hydroxyphenyl)-1-(4-nitroanilino)-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]pentanamide |
| SMILES | CC(C)C(NC(=O)C(N)CCCN=C(N)N)C(=O)NC(Cc1ccc(O)cc1)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H36N8O6/c1-15(2)22(33-23(36)20(27)4-3-13-30-26(28)29)25(38)32-21(14-16-5-11-19(35)12-6-16)24(37)31-17-7-9-18(10-8-17)34(39)40/h5-12,15,20-22,35H,3-4,13-14,27H2,1-2H3,(H,31,37)(H,32,38)(H,33,36)(H4,28,29,30) |
| InChIKey | ZGNURXZBDYLCBE-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 241.09 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|