C29H38N6O8 — CID 59874975
2-[[2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]-3-methyl-N-[1-[[1-(4-nitroanilino)-1-oxobutan-2-yl]amino]-1-oxopropan-2-yl]butanamide (PubChem CID 59874975) has the molecular formula C29H38N6O8 and a molecular weight of 598.66 g/mol. Its IUPAC name is 2-[[2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]-3-methyl-N-[1-[[1-(4-nitroanilino)-1-oxobutan-2-yl]amino]-1-oxopropan-2-yl]butanamide.
| Compound Name | 2-[[2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]-3-methyl-N-[1-[[1-(4-nitroanilino)-1-oxobutan-2-yl]amino]-1-oxopropan-2-yl]butanamide |
|---|---|
| PubChem CID | 59874975 |
| Molecular Formula | C29H38N6O8 |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.28 |
| IUPAC Name | 2-[[2-acetamido-3-(4-hydroxyphenyl)propanoyl]amino]-3-methyl-N-[1-[[1-(4-nitroanilino)-1-oxobutan-2-yl]amino]-1-oxopropan-2-yl]butanamide |
| SMILES | CCC(NC(=O)C(C)NC(=O)C(NC(=O)C(Cc1ccc(O)cc1)NC(C)=O)C(C)C)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C29H38N6O8/c1-6-23(27(39)32-20-9-11-21(12-10-20)35(42)43)33-26(38)17(4)30-29(41)25(16(2)3)34-28(40)24(31-18(5)36)15-19-7-13-22(37)14-8-19/h7-14,16-17,23-25,37H,6,15H2,1-5H3,(H,30,41)(H,31,36)(H,32,39)(H,33,38)(H,34,40) |
| InChIKey | YQHWSBAYPJKNDP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 208.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|