C24H30N6O6 — CID 71403951
(2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-methyl-N-[(2S)-1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]butanamide (PubChem CID 71403951) has the molecular formula C24H30N6O6 and a molecular weight of 498.54 g/mol. Its IUPAC name is (2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-methyl-N-[(2S)-1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]butanamide.
| Compound Name | (2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-methyl-N-[(2S)-1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]butanamide |
|---|---|
| PubChem CID | 71403951 |
| Molecular Formula | C24H30N6O6 |
| Molecular Weight | 498.54 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | (2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-methyl-N-[(2S)-1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]butanamide |
| SMILES | CC(C)[C@H](NC(=O)CNC(=O)CN)C(=O)N[C@@H](Cc1ccccc1)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H30N6O6/c1-15(2)22(29-21(32)14-26-20(31)13-25)24(34)28-19(12-16-6-4-3-5-7-16)23(33)27-17-8-10-18(11-9-17)30(35)36/h3-11,15,19,22H,12-14,25H2,1-2H3,(H,26,31)(H,27,33)(H,28,34)(H,29,32)/t19-,22-/m0/s1 |
| InChIKey | FTTLEOODWWDRJW-UGKGYDQZSA-N |
| XLogP | 0.48 |
| TPSA | 185.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.54 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|