C24H29N5O7 — CID 3609548
tert-butyl N-[2-[[2-[[1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate (PubChem CID 3609548) has the molecular formula C24H29N5O7 and a molecular weight of 499.52 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-[[1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-[[1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 3609548 |
| Molecular Formula | C24H29N5O7 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | tert-butyl N-[2-[[2-[[1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]amino]-2-oxoethyl]amino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)NCC(=O)NC(Cc1ccccc1)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H29N5O7/c1-24(2,3)36-23(33)26-14-20(30)25-15-21(31)28-19(13-16-7-5-4-6-8-16)22(32)27-17-9-11-18(12-10-17)29(34)35/h4-12,19H,13-15H2,1-3H3,(H,25,30)(H,26,33)(H,27,32)(H,28,31) |
| InChIKey | VCWINMOJOGNKQE-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 168.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|