C26H33N5O7 — CID 10792250
tert-butyl N-[(2S)-1-[[(2R)-1-[[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 10792250) has the molecular formula C26H33N5O7 and a molecular weight of 527.58 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(2R)-1-[[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(2R)-1-[[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 10792250 |
| Molecular Formula | C26H33N5O7 |
| Molecular Weight | 527.58 g/mol |
| Exact Mass | 527.24 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(2R)-1-[[(2S)-1-(4-nitroanilino)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]amino]-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)[C@@H](C)NC(=O)[C@H](Cc1ccccc1)NC(=O)OC(C)(C)C)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H33N5O7/c1-16(22(32)27-17(2)23(33)29-19-11-13-20(14-12-19)31(36)37)28-24(34)21(15-18-9-7-6-8-10-18)30-25(35)38-26(3,4)5/h6-14,16-17,21H,15H2,1-5H3,(H,27,32)(H,28,34)(H,29,33)(H,30,35)/t16-,17+,21+/m1/s1 |
| InChIKey | NPOKXRIERGPPDP-WWMYMODYSA-N |
| XLogP | 2.68 |
| TPSA | 168.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.58 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|