C24H28N4O9 — CID 14365062
methyl (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoyl]amino]-3-(4-nitrophenyl)propanoate (PubChem CID 14365062) has the molecular formula C24H28N4O9 and a molecular weight of 516.51 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoyl]amino]-3-(4-nitrophenyl)propanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoyl]amino]-3-(4-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 14365062 |
| Molecular Formula | C24H28N4O9 |
| Molecular Weight | 516.51 g/mol |
| Exact Mass | 516.19 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)propanoyl]amino]-3-(4-nitrophenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc([N+](=O)[O-])cc1)NC(=O)[C@H](Cc1ccc([N+](=O)[O-])cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H28N4O9/c1-24(2,3)37-23(31)26-19(13-15-5-9-17(10-6-15)27(32)33)21(29)25-20(22(30)36-4)14-16-7-11-18(12-8-16)28(34)35/h5-12,19-20H,13-14H2,1-4H3,(H,25,29)(H,26,31)/t19-,20-/m0/s1 |
| InChIKey | IDCUDEOZUALUSH-PMACEKPBSA-N |
| XLogP | 2.84 |
| TPSA | 180.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|