C21H25N3O6 — CID 108767395
tert-butyl N-[1-(2-methoxy-4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]carbamate (PubChem CID 108767395) has the molecular formula C21H25N3O6 and a molecular weight of 415.45 g/mol. Its IUPAC name is tert-butyl N-[1-(2-methoxy-4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-(2-methoxy-4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]carbamate |
|---|---|
| PubChem CID | 108767395 |
| Molecular Formula | C21H25N3O6 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | tert-butyl N-[1-(2-methoxy-4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]carbamate |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)C(Cc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H25N3O6/c1-21(2,3)30-20(26)23-17(12-14-8-6-5-7-9-14)19(25)22-16-11-10-15(24(27)28)13-18(16)29-4/h5-11,13,17H,12H2,1-4H3,(H,22,25)(H,23,26) |
| InChIKey | ZJQQRUOFDPNOQR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|