C34H36N6O8 — CID 67723496
(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-(2,5-dioxopyrrolidin-1-yl)-3-phenylpropanoyl]amino]propanoyl]amino]propanoyl]amino]-N-(4-nitrophenyl)-3-phenylpropanamide (PubChem CID 67723496) has the molecular formula C34H36N6O8 and a molecular weight of 656.70 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-(2,5-dioxopyrrolidin-1-yl)-3-phenylpropanoyl]amino]propanoyl]amino]propanoyl]amino]-N-(4-nitrophenyl)-3-phenylpropanamide.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-(2,5-dioxopyrrolidin-1-yl)-3-phenylpropanoyl]amino]propanoyl]amino]propanoyl]amino]-N-(4-nitrophenyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 67723496 |
| Molecular Formula | C34H36N6O8 |
| Molecular Weight | 656.70 g/mol |
| Exact Mass | 656.26 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-(2,5-dioxopyrrolidin-1-yl)-3-phenylpropanoyl]amino]propanoyl]amino]propanoyl]amino]-N-(4-nitrophenyl)-3-phenylpropanamide |
| SMILES | C[C@H](NC(=O)[C@H](C)NC(=O)[C@H](Cc1ccccc1)N1C(=O)CCC1=O)C(=O)N[C@@H](Cc1ccccc1)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C34H36N6O8/c1-21(36-34(46)28(20-24-11-7-4-8-12-24)39-29(41)17-18-30(39)42)31(43)35-22(2)32(44)38-27(19-23-9-5-3-6-10-23)33(45)37-25-13-15-26(16-14-25)40(47)48/h3-16,21-22,27-28H,17-20H2,1-2H3,(H,35,43)(H,36,46)(H,37,45)(H,38,44)/t21-,22-,27-,28-/m0/s1 |
| InChIKey | AMCIDRFSGWFYDZ-MPPVQRIUSA-N |
| XLogP | 2.03 |
| TPSA | 196.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.70 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|