C25H26N6O5 — CID 141192192
(2S)-2-[[(2R)-2-[(2-aminoacetyl)amino]-2-(4-nitroanilino)acetyl]amino]-N,3-diphenylpropanamide (PubChem CID 141192192) has the molecular formula C25H26N6O5 and a molecular weight of 490.52 g/mol. Its IUPAC name is (2S)-2-[[(2R)-2-[(2-aminoacetyl)amino]-2-(4-nitroanilino)acetyl]amino]-N,3-diphenylpropanamide.
| Compound Name | (2S)-2-[[(2R)-2-[(2-aminoacetyl)amino]-2-(4-nitroanilino)acetyl]amino]-N,3-diphenylpropanamide |
|---|---|
| PubChem CID | 141192192 |
| Molecular Formula | C25H26N6O5 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | (2S)-2-[[(2R)-2-[(2-aminoacetyl)amino]-2-(4-nitroanilino)acetyl]amino]-N,3-diphenylpropanamide |
| SMILES | NCC(=O)N[C@@H](Nc1ccc([N+](=O)[O-])cc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C25H26N6O5/c26-16-22(32)30-23(27-19-11-13-20(14-12-19)31(35)36)25(34)29-21(15-17-7-3-1-4-8-17)24(33)28-18-9-5-2-6-10-18/h1-14,21,23,27H,15-16,26H2,(H,28,33)(H,29,34)(H,30,32)/t21-,23+/m0/s1 |
| InChIKey | CLJZOOUXZVOJAK-JTHBVZDNSA-N |
| XLogP | 1.77 |
| TPSA | 168.49 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|