C15H16N3O3+ — CID 7408125
[(2S)-1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]azanium (PubChem CID 7408125) has the molecular formula C15H16N3O3+ and a molecular weight of 286.31 g/mol. Its IUPAC name is [(2S)-1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]azanium.
| Compound Name | [(2S)-1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]azanium |
|---|---|
| PubChem CID | 7408125 |
| Molecular Formula | C15H16N3O3+ |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | [(2S)-1-(4-nitroanilino)-1-oxo-3-phenylpropan-2-yl]azanium |
| SMILES | [NH3+][C@@H](Cc1ccccc1)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H15N3O3/c16-14(10-11-4-2-1-3-5-11)15(19)17-12-6-8-13(9-7-12)18(20)21/h1-9,14H,10,16H2,(H,17,19)/p+1/t14-/m0/s1 |
| InChIKey | GJHIOWXZFDVUKQ-AWEZNQCLSA-O |
| XLogP | 1.39 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|