C11H16N3O3S+ — CID 7408196
[(2S)-4-methylsulfanyl-1-(4-nitroanilino)-1-oxobutan-2-yl]azanium (PubChem CID 7408196) has the molecular formula C11H16N3O3S+ and a molecular weight of 270.33 g/mol. Its IUPAC name is [(2S)-4-methylsulfanyl-1-(4-nitroanilino)-1-oxobutan-2-yl]azanium.
| Compound Name | [(2S)-4-methylsulfanyl-1-(4-nitroanilino)-1-oxobutan-2-yl]azanium |
|---|---|
| PubChem CID | 7408196 |
| Molecular Formula | C11H16N3O3S+ |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | [(2S)-4-methylsulfanyl-1-(4-nitroanilino)-1-oxobutan-2-yl]azanium |
| SMILES | CSCC[C@H]([NH3+])C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H15N3O3S/c1-18-7-6-10(12)11(15)13-8-2-4-9(5-3-8)14(16)17/h2-5,10H,6-7,12H2,1H3,(H,13,15)/p+1/t10-/m0/s1 |
| InChIKey | PLBWRAWSHVJPTL-JTQLQIEISA-O |
| XLogP | 0.90 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|