C13H18N2O6S2 — CID 139801356
ethyl (2R)-4-methylsulfanyl-2-[(4-nitrophenyl)sulfonylamino]butanoate (PubChem CID 139801356) has the molecular formula C13H18N2O6S2 and a molecular weight of 362.43 g/mol. Its IUPAC name is ethyl (2R)-4-methylsulfanyl-2-[(4-nitrophenyl)sulfonylamino]butanoate.
| Compound Name | ethyl (2R)-4-methylsulfanyl-2-[(4-nitrophenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 139801356 |
| Molecular Formula | C13H18N2O6S2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | ethyl (2R)-4-methylsulfanyl-2-[(4-nitrophenyl)sulfonylamino]butanoate |
| SMILES | CCOC(=O)[C@@H](CCSC)NS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H18N2O6S2/c1-3-21-13(16)12(8-9-22-2)14-23(19,20)11-6-4-10(5-7-11)15(17)18/h4-7,12,14H,3,8-9H2,1-2H3/t12-/m1/s1 |
| InChIKey | ITTBTFZQJSMUHJ-GFCCVEGCSA-N |
| XLogP | 1.56 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|