C12H15N2O11PS — CID 102427295
1-O-ethyl 4-O-phosphono (2S)-2-[(4-nitrophenyl)sulfonylamino]butanedioate (PubChem CID 102427295) has the molecular formula C12H15N2O11PS and a molecular weight of 426.30 g/mol. Its IUPAC name is 1-O-ethyl 4-O-phosphono (2S)-2-[(4-nitrophenyl)sulfonylamino]butanedioate.
| Compound Name | 1-O-ethyl 4-O-phosphono (2S)-2-[(4-nitrophenyl)sulfonylamino]butanedioate |
|---|---|
| PubChem CID | 102427295 |
| Molecular Formula | C12H15N2O11PS |
| Molecular Weight | 426.30 g/mol |
| Exact Mass | 426.01 |
| IUPAC Name | 1-O-ethyl 4-O-phosphono (2S)-2-[(4-nitrophenyl)sulfonylamino]butanedioate |
| SMILES | CCOC(=O)[C@H](CC(=O)OP(=O)(O)O)NS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H15N2O11PS/c1-2-24-12(16)10(7-11(15)25-26(19,20)21)13-27(22,23)9-5-3-8(4-6-9)14(17)18/h3-6,10,13H,2,7H2,1H3,(H2,19,20,21)/t10-/m0/s1 |
| InChIKey | BCRSOXTXYAVEFA-JTQLQIEISA-N |
| XLogP | -0.17 |
| TPSA | 199.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.30 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|