C25H31N3O9S — CID 154526156
[4-[(1-ethoxy-3-morpholin-4-yl-1-oxopropan-2-yl)sulfamoyl]phenyl] 2-(4-nitrophenyl)butanoate (PubChem CID 154526156) has the molecular formula C25H31N3O9S and a molecular weight of 549.60 g/mol. Its IUPAC name is [4-[(1-ethoxy-3-morpholin-4-yl-1-oxopropan-2-yl)sulfamoyl]phenyl] 2-(4-nitrophenyl)butanoate.
| Compound Name | [4-[(1-ethoxy-3-morpholin-4-yl-1-oxopropan-2-yl)sulfamoyl]phenyl] 2-(4-nitrophenyl)butanoate |
|---|---|
| PubChem CID | 154526156 |
| Molecular Formula | C25H31N3O9S |
| Molecular Weight | 549.60 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | [4-[(1-ethoxy-3-morpholin-4-yl-1-oxopropan-2-yl)sulfamoyl]phenyl] 2-(4-nitrophenyl)butanoate |
| SMILES | CCOC(=O)C(CN1CCOCC1)NS(=O)(=O)c1ccc(OC(=O)C(CC)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C25H31N3O9S/c1-3-22(18-5-7-19(8-6-18)28(31)32)24(29)37-20-9-11-21(12-10-20)38(33,34)26-23(25(30)36-4-2)17-27-13-15-35-16-14-27/h5-12,22-23,26H,3-4,13-17H2,1-2H3 |
| InChIKey | ITGPGPUGZPTSSF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.60 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|