C14H20N2O6S2 — CID 139801325
propyl (2R)-4-methylsulfanyl-2-[(4-nitrophenyl)sulfonylamino]butanoate (PubChem CID 139801325) has the molecular formula C14H20N2O6S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is propyl (2R)-4-methylsulfanyl-2-[(4-nitrophenyl)sulfonylamino]butanoate.
| Compound Name | propyl (2R)-4-methylsulfanyl-2-[(4-nitrophenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 139801325 |
| Molecular Formula | C14H20N2O6S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | propyl (2R)-4-methylsulfanyl-2-[(4-nitrophenyl)sulfonylamino]butanoate |
| SMILES | CCCOC(=O)[C@@H](CCSC)NS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H20N2O6S2/c1-3-9-22-14(17)13(8-10-23-2)15-24(20,21)12-6-4-11(5-7-12)16(18)19/h4-7,13,15H,3,8-10H2,1-2H3/t13-/m1/s1 |
| InChIKey | DHWSKSUHAJIVMA-CYBMUJFWSA-N |
| XLogP | 1.95 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|