C13H17BrN2O6S — CID 139765023
propan-2-yl (2R)-4-bromo-2-[(4-nitrophenyl)sulfonylamino]butanoate (PubChem CID 139765023) has the molecular formula C13H17BrN2O6S and a molecular weight of 409.26 g/mol. Its IUPAC name is propan-2-yl (2R)-4-bromo-2-[(4-nitrophenyl)sulfonylamino]butanoate.
| Compound Name | propan-2-yl (2R)-4-bromo-2-[(4-nitrophenyl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 139765023 |
| Molecular Formula | C13H17BrN2O6S |
| Molecular Weight | 409.26 g/mol |
| Exact Mass | 408.00 |
| IUPAC Name | propan-2-yl (2R)-4-bromo-2-[(4-nitrophenyl)sulfonylamino]butanoate |
| SMILES | CC(C)OC(=O)[C@@H](CCBr)NS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C13H17BrN2O6S/c1-9(2)22-13(17)12(7-8-14)15-23(20,21)11-5-3-10(4-6-11)16(18)19/h3-6,9,12,15H,7-8H2,1-2H3/t12-/m1/s1 |
| InChIKey | GOJYYMRGPPOQHL-GFCCVEGCSA-N |
| XLogP | 1.98 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.26 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|