C16H24N2O6S — CID 10970738
tert-butyl (2S)-4-methyl-2-[(4-nitrophenyl)sulfonylamino]pentanoate (PubChem CID 10970738) has the molecular formula C16H24N2O6S and a molecular weight of 372.44 g/mol. Its IUPAC name is tert-butyl (2S)-4-methyl-2-[(4-nitrophenyl)sulfonylamino]pentanoate.
| Compound Name | tert-butyl (2S)-4-methyl-2-[(4-nitrophenyl)sulfonylamino]pentanoate |
|---|---|
| PubChem CID | 10970738 |
| Molecular Formula | C16H24N2O6S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | tert-butyl (2S)-4-methyl-2-[(4-nitrophenyl)sulfonylamino]pentanoate |
| SMILES | CC(C)C[C@H](NS(=O)(=O)c1ccc([N+](=O)[O-])cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H24N2O6S/c1-11(2)10-14(15(19)24-16(3,4)5)17-25(22,23)13-8-6-12(7-9-13)18(20)21/h6-9,11,14,17H,10H2,1-5H3/t14-/m0/s1 |
| InChIKey | HXRYKJRCABDEHI-AWEZNQCLSA-N |
| XLogP | 2.63 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|