C21H33N3O6 — CID 56633865
tert-butyl 2-[[(3S,4S)-4-amino-3-hydroxy-5-(4-nitrophenyl)pentanoyl]amino]-4-methylpentanoate (PubChem CID 56633865) has the molecular formula C21H33N3O6 and a molecular weight of 423.51 g/mol. Its IUPAC name is tert-butyl 2-[[(3S,4S)-4-amino-3-hydroxy-5-(4-nitrophenyl)pentanoyl]amino]-4-methylpentanoate.
| Compound Name | tert-butyl 2-[[(3S,4S)-4-amino-3-hydroxy-5-(4-nitrophenyl)pentanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 56633865 |
| Molecular Formula | C21H33N3O6 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.24 |
| IUPAC Name | tert-butyl 2-[[(3S,4S)-4-amino-3-hydroxy-5-(4-nitrophenyl)pentanoyl]amino]-4-methylpentanoate |
| SMILES | CC(C)CC(NC(=O)C[C@H](O)[C@@H](N)Cc1ccc([N+](=O)[O-])cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H33N3O6/c1-13(2)10-17(20(27)30-21(3,4)5)23-19(26)12-18(25)16(22)11-14-6-8-15(9-7-14)24(28)29/h6-9,13,16-18,25H,10-12,22H2,1-5H3,(H,23,26)/t16-,17?,18-/m0/s1 |
| InChIKey | ZOOVNLWEQNLELK-RGBJRUIASA-N |
| XLogP | 2.09 |
| TPSA | 144.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|