C33H40N4O7 — CID 10304245
tert-butyl (2S)-2-[[(2S)-4-methyl-2-[(4-nitrophenyl)carbamoylamino]pentanoyl]amino]-3-(4-phenylmethoxyphenyl)propanoate (PubChem CID 10304245) has the molecular formula C33H40N4O7 and a molecular weight of 604.70 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2S)-4-methyl-2-[(4-nitrophenyl)carbamoylamino]pentanoyl]amino]-3-(4-phenylmethoxyphenyl)propanoate.
| Compound Name | tert-butyl (2S)-2-[[(2S)-4-methyl-2-[(4-nitrophenyl)carbamoylamino]pentanoyl]amino]-3-(4-phenylmethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 10304245 |
| Molecular Formula | C33H40N4O7 |
| Molecular Weight | 604.70 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | tert-butyl (2S)-2-[[(2S)-4-methyl-2-[(4-nitrophenyl)carbamoylamino]pentanoyl]amino]-3-(4-phenylmethoxyphenyl)propanoate |
| SMILES | CC(C)C[C@H](NC(=O)Nc1ccc([N+](=O)[O-])cc1)C(=O)N[C@@H](Cc1ccc(OCc2ccccc2)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C33H40N4O7/c1-22(2)19-28(36-32(40)34-25-13-15-26(16-14-25)37(41)42)30(38)35-29(31(39)44-33(3,4)5)20-23-11-17-27(18-12-23)43-21-24-9-7-6-8-10-24/h6-18,22,28-29H,19-21H2,1-5H3,(H,35,38)(H2,34,36,40)/t28-,29-/m0/s1 |
| InChIKey | ODDLUUQOQJMNMU-VMPREFPWSA-N |
| XLogP | 5.78 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.70 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|