C13H18N2O4 — CID 150316550
[2,3-dimethyl-4-(4-nitrophenyl)butan-2-yl] carbamate (PubChem CID 150316550) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is [2,3-dimethyl-4-(4-nitrophenyl)butan-2-yl] carbamate.
| Compound Name | [2,3-dimethyl-4-(4-nitrophenyl)butan-2-yl] carbamate |
|---|---|
| PubChem CID | 150316550 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | [2,3-dimethyl-4-(4-nitrophenyl)butan-2-yl] carbamate |
| SMILES | CC(Cc1ccc([N+](=O)[O-])cc1)C(C)(C)OC(N)=O |
| InChI | InChI=1S/C13H18N2O4/c1-9(13(2,3)19-12(14)16)8-10-4-6-11(7-5-10)15(17)18/h4-7,9H,8H2,1-3H3,(H2,14,16) |
| InChIKey | GMSOMFNSWPXTIX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|