C14H18BrNO4 — CID 14951025
tert-butyl 2-bromo-4-(4-nitrophenyl)butanoate (PubChem CID 14951025) has the molecular formula C14H18BrNO4 and a molecular weight of 344.21 g/mol. Its IUPAC name is tert-butyl 2-bromo-4-(4-nitrophenyl)butanoate.
| Compound Name | tert-butyl 2-bromo-4-(4-nitrophenyl)butanoate |
|---|---|
| PubChem CID | 14951025 |
| Molecular Formula | C14H18BrNO4 |
| Molecular Weight | 344.21 g/mol |
| Exact Mass | 343.04 |
| IUPAC Name | tert-butyl 2-bromo-4-(4-nitrophenyl)butanoate |
| SMILES | CC(C)(C)OC(=O)C(Br)CCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H18BrNO4/c1-14(2,3)20-13(17)12(15)9-6-10-4-7-11(8-5-10)16(18)19/h4-5,7-8,12H,6,9H2,1-3H3 |
| InChIKey | LGRLNBNTBKWZDK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.21 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|