C28H44N4O8 — CID 139570247
2-[4,7-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7-triazonan-1-yl]-4-(4-nitrophenyl)butanoic acid (PubChem CID 139570247) has the molecular formula C28H44N4O8 and a molecular weight of 564.68 g/mol. Its IUPAC name is 2-[4,7-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7-triazonan-1-yl]-4-(4-nitrophenyl)butanoic acid.
| Compound Name | 2-[4,7-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7-triazonan-1-yl]-4-(4-nitrophenyl)butanoic acid |
|---|---|
| PubChem CID | 139570247 |
| Molecular Formula | C28H44N4O8 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.32 |
| IUPAC Name | 2-[4,7-bis[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7-triazonan-1-yl]-4-(4-nitrophenyl)butanoic acid |
| SMILES | CC(C)(C)OC(=O)CN1CCN(CC(=O)OC(C)(C)C)CCN(C(CCc2ccc([N+](=O)[O-])cc2)C(=O)O)CC1 |
| InChI | InChI=1S/C28H44N4O8/c1-27(2,3)39-24(33)19-29-13-14-30(20-25(34)40-28(4,5)6)16-18-31(17-15-29)23(26(35)36)12-9-21-7-10-22(11-8-21)32(37)38/h7-8,10-11,23H,9,12-20H2,1-6H3,(H,35,36) |
| InChIKey | KQOZUYZGKNXAJO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 142.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|