C40H68N4O9 — CID 174172246
(2S)-6-(4-ethoxyphenyl)-2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]hexanoic acid (PubChem CID 174172246) has the molecular formula C40H68N4O9 and a molecular weight of 749.00 g/mol. Its IUPAC name is (2S)-6-(4-ethoxyphenyl)-2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]hexanoic acid.
| Compound Name | (2S)-6-(4-ethoxyphenyl)-2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 174172246 |
| Molecular Formula | C40H68N4O9 |
| Molecular Weight | 749.00 g/mol |
| Exact Mass | 748.50 |
| IUPAC Name | (2S)-6-(4-ethoxyphenyl)-2-[4,7,10-tris[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,4,7,10-tetrazacyclododec-1-yl]hexanoic acid |
| SMILES | CCOc1ccc(CCCC[C@@H](C(=O)O)N2CCN(CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CCN(CC(=O)OC(C)(C)C)CC2)cc1 |
| InChI | InChI=1S/C40H68N4O9/c1-11-50-32-18-16-31(17-19-32)14-12-13-15-33(37(48)49)44-26-24-42(29-35(46)52-39(5,6)7)22-20-41(28-34(45)51-38(2,3)4)21-23-43(25-27-44)30-36(47)53-40(8,9)10/h16-19,33H,11-15,20-30H2,1-10H3,(H,48,49)/t33-/m0/s1 |
| InChIKey | LJUSONAKYYPUGU-XIFFEERXSA-N |
| XLogP | 4.50 |
| TPSA | 138.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.00 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|