C34H56GdN4O14 — CID 170648038
(2S)-5-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-[4,7,10-tris[(1R)-1-carboxy-2-hydroxyethyl]-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid;gadolinium (PubChem CID 170648038) has the molecular formula C34H56GdN4O14 and a molecular weight of 902.09 g/mol. Its IUPAC name is (2S)-5-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-[4,7,10-tris[(1R)-1-carboxy-2-hydroxyethyl]-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid;gadolinium.
| Compound Name | (2S)-5-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-[4,7,10-tris[(1R)-1-carboxy-2-hydroxyethyl]-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid;gadolinium |
|---|---|
| PubChem CID | 170648038 |
| Molecular Formula | C34H56GdN4O14 |
| Molecular Weight | 902.09 g/mol |
| Exact Mass | 902.30 |
| IUPAC Name | (2S)-5-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-[4,7,10-tris[(1R)-1-carboxy-2-hydroxyethyl]-1,4,7,10-tetrazacyclododec-1-yl]pentanoic acid;gadolinium |
| SMILES | CCOCCOCCOc1ccc(CCC[C@@H](C(=O)O)N2CCN([C@H](CO)C(=O)O)CCN([C@H](CO)C(=O)O)CCN([C@H](CO)C(=O)O)CC2)cc1.[Gd] |
| InChI | InChI=1S/C34H56N4O14.Gd/c1-2-50-18-19-51-20-21-52-26-8-6-25(7-9-26)4-3-5-27(31(42)43)35-10-12-36(28(22-39)32(44)45)14-16-38(30(24-41)34(48)49)17-15-37(13-11-35)29(23-40)33(46)47;/h6-9,27-30,39-41H,2-5,10-24H2,1H3,(H,42,43)(H,44,45)(H,46,47)(H,48,49);/t27-,28+,29+,30+;/m0./s1 |
| InChIKey | JTTREPGOIQUWBI-XZHSTTBUSA-N |
| XLogP | -1.55 |
| TPSA | 250.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 53 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.09 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|