C18H28O8S — CID 174172214
(2R)-5-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-methylsulfonyloxypentanoic acid (PubChem CID 174172214) has the molecular formula C18H28O8S and a molecular weight of 404.48 g/mol. Its IUPAC name is (2R)-5-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-methylsulfonyloxypentanoic acid.
| Compound Name | (2R)-5-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-methylsulfonyloxypentanoic acid |
|---|---|
| PubChem CID | 174172214 |
| Molecular Formula | C18H28O8S |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | (2R)-5-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-methylsulfonyloxypentanoic acid |
| SMILES | CCOCCOCCOc1ccc(CCC[C@@H](OS(C)(=O)=O)C(=O)O)cc1 |
| InChI | InChI=1S/C18H28O8S/c1-3-23-11-12-24-13-14-25-16-9-7-15(8-10-16)5-4-6-17(18(19)20)26-27(2,21)22/h7-10,17H,3-6,11-14H2,1-2H3,(H,19,20)/t17-/m1/s1 |
| InChIKey | MYLSLOVGOFWJDC-QGZVFWFLSA-N |
| XLogP | 1.87 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|