C18H28O6 — CID 165125468
methyl (2R)-5-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-hydroxypentanoate (PubChem CID 165125468) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is methyl (2R)-5-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-hydroxypentanoate.
| Compound Name | methyl (2R)-5-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-hydroxypentanoate |
|---|---|
| PubChem CID | 165125468 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | methyl (2R)-5-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-hydroxypentanoate |
| SMILES | CCOCCOCCOc1ccc(CCC[C@@H](O)C(=O)OC)cc1 |
| InChI | InChI=1S/C18H28O6/c1-3-22-11-12-23-13-14-24-16-9-7-15(8-10-16)5-4-6-17(19)18(20)21-2/h7-10,17,19H,3-6,11-14H2,1-2H3/t17-/m1/s1 |
| InChIKey | ZLPXMYQBTHOZHD-QGZVFWFLSA-N |
| XLogP | 1.98 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|