C17H26O6 — CID 174172216
(2R)-5-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-hydroxypentanoic acid (PubChem CID 174172216) has the molecular formula C17H26O6 and a molecular weight of 326.39 g/mol. Its IUPAC name is (2R)-5-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-hydroxypentanoic acid.
| Compound Name | (2R)-5-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-hydroxypentanoic acid |
|---|---|
| PubChem CID | 174172216 |
| Molecular Formula | C17H26O6 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | (2R)-5-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-hydroxypentanoic acid |
| SMILES | CCOCCOCCOc1ccc(CCC[C@@H](O)C(=O)O)cc1 |
| InChI | InChI=1S/C17H26O6/c1-2-21-10-11-22-12-13-23-15-8-6-14(7-9-15)4-3-5-16(18)17(19)20/h6-9,16,18H,2-5,10-13H2,1H3,(H,19,20)/t16-/m1/s1 |
| InChIKey | VDJXQTYYYRNFDF-MRXNPFEDSA-N |
| XLogP | 1.89 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|