C17H26O7 — CID 174172244
(2S)-3-[4-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]phenyl]-2-hydroxypropanoic acid (PubChem CID 174172244) has the molecular formula C17H26O7 and a molecular weight of 342.39 g/mol. Its IUPAC name is (2S)-3-[4-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]phenyl]-2-hydroxypropanoic acid.
| Compound Name | (2S)-3-[4-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]phenyl]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 174172244 |
| Molecular Formula | C17H26O7 |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (2S)-3-[4-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]phenyl]-2-hydroxypropanoic acid |
| SMILES | CCOCCOCCOCCOc1ccc(C[C@H](O)C(=O)O)cc1 |
| InChI | InChI=1S/C17H26O7/c1-2-21-7-8-22-9-10-23-11-12-24-15-5-3-14(4-6-15)13-16(18)17(19)20/h3-6,16,18H,2,7-13H2,1H3,(H,19,20)/t16-/m0/s1 |
| InChIKey | AYWJFCYWWHIIHX-INIZCTEOSA-N |
| XLogP | 1.12 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|