C20H33NO6 — CID 174215966
tert-butyl-[1-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-3-hydroxypropan-2-yl]carbamic acid (PubChem CID 174215966) has the molecular formula C20H33NO6 and a molecular weight of 383.49 g/mol. Its IUPAC name is tert-butyl-[1-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-3-hydroxypropan-2-yl]carbamic acid.
| Compound Name | tert-butyl-[1-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-3-hydroxypropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 174215966 |
| Molecular Formula | C20H33NO6 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.23 |
| IUPAC Name | tert-butyl-[1-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-3-hydroxypropan-2-yl]carbamic acid |
| SMILES | CCOCCOCCOc1ccc(CC(CO)N(C(=O)O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H33NO6/c1-5-25-10-11-26-12-13-27-18-8-6-16(7-9-18)14-17(15-22)21(19(23)24)20(2,3)4/h6-9,17,22H,5,10-15H2,1-4H3,(H,23,24) |
| InChIKey | LOYPAZSLZSPZAK-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|