C22H37NO7 — CID 174215983
tert-butyl-[1-[4-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]phenyl]-3-hydroxypropan-2-yl]carbamic acid (PubChem CID 174215983) has the molecular formula C22H37NO7 and a molecular weight of 427.54 g/mol. Its IUPAC name is tert-butyl-[1-[4-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]phenyl]-3-hydroxypropan-2-yl]carbamic acid.
| Compound Name | tert-butyl-[1-[4-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]phenyl]-3-hydroxypropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 174215983 |
| Molecular Formula | C22H37NO7 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.26 |
| IUPAC Name | tert-butyl-[1-[4-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]phenyl]-3-hydroxypropan-2-yl]carbamic acid |
| SMILES | CCOCCOCCOCCOc1ccc(CC(CO)N(C(=O)O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H37NO7/c1-5-27-10-11-28-12-13-29-14-15-30-20-8-6-18(7-9-20)16-19(17-24)23(21(25)26)22(2,3)4/h6-9,19,24H,5,10-17H2,1-4H3,(H,25,26) |
| InChIKey | SBRCRJARQMXLIJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|