C18H31N3O3 — CID 146482980
[(2S)-1-(2-aminoethylamino)-3-(4-ethoxyphenyl)propan-2-yl]-tert-butylcarbamic acid (PubChem CID 146482980) has the molecular formula C18H31N3O3 and a molecular weight of 337.46 g/mol. Its IUPAC name is [(2S)-1-(2-aminoethylamino)-3-(4-ethoxyphenyl)propan-2-yl]-tert-butylcarbamic acid.
| Compound Name | [(2S)-1-(2-aminoethylamino)-3-(4-ethoxyphenyl)propan-2-yl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 146482980 |
| Molecular Formula | C18H31N3O3 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.24 |
| IUPAC Name | [(2S)-1-(2-aminoethylamino)-3-(4-ethoxyphenyl)propan-2-yl]-tert-butylcarbamic acid |
| SMILES | CCOc1ccc(C[C@@H](CNCCN)N(C(=O)O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H31N3O3/c1-5-24-16-8-6-14(7-9-16)12-15(13-20-11-10-19)21(17(22)23)18(2,3)4/h6-9,15,20H,5,10-13,19H2,1-4H3,(H,22,23)/t15-/m0/s1 |
| InChIKey | SDGNANNSCKKKJQ-HNNXBMFYSA-N |
| XLogP | 2.32 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|