C21H29N3O3 — CID 19030069
benzyl N-[1-(2-aminoethylamino)-3-(4-ethoxyphenyl)propan-2-yl]carbamate (PubChem CID 19030069) has the molecular formula C21H29N3O3 and a molecular weight of 371.48 g/mol. Its IUPAC name is benzyl N-[1-(2-aminoethylamino)-3-(4-ethoxyphenyl)propan-2-yl]carbamate.
| Compound Name | benzyl N-[1-(2-aminoethylamino)-3-(4-ethoxyphenyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 19030069 |
| Molecular Formula | C21H29N3O3 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.22 |
| IUPAC Name | benzyl N-[1-(2-aminoethylamino)-3-(4-ethoxyphenyl)propan-2-yl]carbamate |
| SMILES | CCOc1ccc(CC(CNCCN)NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H29N3O3/c1-2-26-20-10-8-17(9-11-20)14-19(15-23-13-12-22)24-21(25)27-16-18-6-4-3-5-7-18/h3-11,19,23H,2,12-16,22H2,1H3,(H,24,25) |
| InChIKey | JONRIDPCVXLNHZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|