C22H23NO6 — CID 67642564
ethyl 2,3-dioxo-6-phenyl-5-(phenylmethoxycarbonylamino)hexanoate (PubChem CID 67642564) has the molecular formula C22H23NO6 and a molecular weight of 397.43 g/mol. Its IUPAC name is ethyl 2,3-dioxo-6-phenyl-5-(phenylmethoxycarbonylamino)hexanoate.
| Compound Name | ethyl 2,3-dioxo-6-phenyl-5-(phenylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 67642564 |
| Molecular Formula | C22H23NO6 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | ethyl 2,3-dioxo-6-phenyl-5-(phenylmethoxycarbonylamino)hexanoate |
| SMILES | CCOC(=O)C(=O)C(=O)CC(Cc1ccccc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H23NO6/c1-2-28-21(26)20(25)19(24)14-18(13-16-9-5-3-6-10-16)23-22(27)29-15-17-11-7-4-8-12-17/h3-12,18H,2,13-15H2,1H3,(H,23,27) |
| InChIKey | KOMPRNUHDGLRBW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|